C22H22N4O4 — CID 135829498
trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]cyclopropane-1-carboxamide (PubChem CID 135829498) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135829498 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc([C@@H]2C[C@H]2C(=O)/N=N/c2c(O)[nH]c3ccc([N+](=O)[O-])cc23)cc1 |
| InChI | InChI=1S/C22H22N4O4/c1-22(2,3)13-6-4-12(5-7-13)15-11-16(15)20(27)25-24-19-17-10-14(26(29)30)8-9-18(17)23-21(19)28/h4-10,15-16,23,28H,11H2,1-3H3/b25-24+/t15-,16+/m0/s1 |
| InChIKey | GLMMDSQQRUSVPO-VGLIGUEGSA-N |
| XLogP | 5.49 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|