C17H13FN4O3 — CID 135785168
N'-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-N-(4-methylphenyl)oxamide (PubChem CID 135785168) has the molecular formula C17H13FN4O3 and a molecular weight of 340.31 g/mol. Its IUPAC name is N'-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 135785168 |
| Molecular Formula | C17H13FN4O3 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N'-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-N-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)/N=N/c2c(O)[nH]c3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C17H13FN4O3/c1-9-2-5-11(6-3-9)19-16(24)17(25)22-21-14-12-8-10(18)4-7-13(12)20-15(14)23/h2-8,20,23H,1H3,(H,19,24)/b22-21+ |
| InChIKey | ROPFUNKKUOBSAD-QURGRASLSA-N |
| XLogP | 3.57 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|