C25H17FN4O2 — CID 135758877
N-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-2-(4-methylphenyl)quinoline-4-carboxamide (PubChem CID 135758877) has the molecular formula C25H17FN4O2 and a molecular weight of 424.44 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-2-(4-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-2-(4-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 135758877 |
| Molecular Formula | C25H17FN4O2 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-2-(4-methylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)/N=N/c3c(O)[nH]c4ccc(F)cc34)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H17FN4O2/c1-14-6-8-15(9-7-14)22-13-18(17-4-2-3-5-20(17)27-22)24(31)30-29-23-19-12-16(26)10-11-21(19)28-25(23)32/h2-13,28,32H,1H3/b30-29+ |
| InChIKey | HCESBKVKKUHEFD-QVIHXGFCSA-N |
| XLogP | 6.46 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|