C20H18N4O3S — CID 53380421
6-(2-phenylethylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide (PubChem CID 53380421) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is 6-(2-phenylethylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide.
| Compound Name | 6-(2-phenylethylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide |
|---|---|
| PubChem CID | 53380421 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 6-(2-phenylethylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide |
| SMILES | NC(=O)c1nccc2c1[nH]c1ccc(S(=O)(=O)NCCc3ccccc3)cc12 |
| InChI | InChI=1S/C20H18N4O3S/c21-20(25)19-18-15(9-10-22-19)16-12-14(6-7-17(16)24-18)28(26,27)23-11-8-13-4-2-1-3-5-13/h1-7,9-10,12,23-24H,8,11H2,(H2,21,25) |
| InChIKey | YOXQJONNKRKRRX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |