C28H31BrNO6PS — CID 143230631
ethane;ethyl 1-(benzenesulfonyl)-3-[(3-bromo-5-methylphenyl)-methoxyphosphoryl]-5-methylindole-2-carboxylate (PubChem CID 143230631) has the molecular formula C28H31BrNO6PS and a molecular weight of 620.50 g/mol. Its IUPAC name is ethane;ethyl 1-(benzenesulfonyl)-3-[(3-bromo-5-methylphenyl)-methoxyphosphoryl]-5-methylindole-2-carboxylate.
| Compound Name | ethane;ethyl 1-(benzenesulfonyl)-3-[(3-bromo-5-methylphenyl)-methoxyphosphoryl]-5-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 143230631 |
| Molecular Formula | C28H31BrNO6PS |
| Molecular Weight | 620.50 g/mol |
| Exact Mass | 619.08 |
| IUPAC Name | ethane;ethyl 1-(benzenesulfonyl)-3-[(3-bromo-5-methylphenyl)-methoxyphosphoryl]-5-methylindole-2-carboxylate |
| SMILES | CC.CCOC(=O)c1c(P(=O)(OC)c2cc(C)cc(Br)c2)c2cc(C)ccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H25BrNO6PS.C2H6/c1-5-34-26(29)24-25(35(30,33-4)20-14-18(3)13-19(27)16-20)22-15-17(2)11-12-23(22)28(24)36(31,32)21-9-7-6-8-10-21;1-2/h6-16H,5H2,1-4H3;1-2H3 |
| InChIKey | HXNPUTCMLMZKPI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|