C29H25ClFN2O6PS — CID 76797919
ethyl 1-(benzenesulfonyl)-5-chloro-3-[[3-(2-cyanoethenyl)-5-methylphenyl]-ethoxyphosphoryl]-4-fluoroindole-2-carboxylate (PubChem CID 76797919) has the molecular formula C29H25ClFN2O6PS and a molecular weight of 615.02 g/mol. Its IUPAC name is ethyl 1-(benzenesulfonyl)-5-chloro-3-[[3-(2-cyanoethenyl)-5-methylphenyl]-ethoxyphosphoryl]-4-fluoroindole-2-carboxylate.
| Compound Name | ethyl 1-(benzenesulfonyl)-5-chloro-3-[[3-(2-cyanoethenyl)-5-methylphenyl]-ethoxyphosphoryl]-4-fluoroindole-2-carboxylate |
|---|---|
| PubChem CID | 76797919 |
| Molecular Formula | C29H25ClFN2O6PS |
| Molecular Weight | 615.02 g/mol |
| Exact Mass | 614.08 |
| IUPAC Name | ethyl 1-(benzenesulfonyl)-5-chloro-3-[[3-(2-cyanoethenyl)-5-methylphenyl]-ethoxyphosphoryl]-4-fluoroindole-2-carboxylate |
| SMILES | CCOC(=O)c1c(P(=O)(OCC)c2cc(C)cc(C=CC#N)c2)c2c(F)c(Cl)ccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H25ClFN2O6PS/c1-4-38-29(34)27-28(40(35,39-5-2)21-17-19(3)16-20(18-21)10-9-15-32)25-24(14-13-23(30)26(25)31)33(27)41(36,37)22-11-7-6-8-12-22/h6-14,16-18H,4-5H2,1-3H3 |
| InChIKey | GQVGZTVCQQLERF-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 115.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.02 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|