C26H21Cl2N3O5S — CID 142627137
ethyl 3-[3-(2-aminoanilino)-3-oxoprop-1-en-2-yl]-1-(benzenesulfonyl)-4,6-dichloroindole-2-carboxylate (PubChem CID 142627137) has the molecular formula C26H21Cl2N3O5S and a molecular weight of 558.44 g/mol. Its IUPAC name is ethyl 3-[3-(2-aminoanilino)-3-oxoprop-1-en-2-yl]-1-(benzenesulfonyl)-4,6-dichloroindole-2-carboxylate.
| Compound Name | ethyl 3-[3-(2-aminoanilino)-3-oxoprop-1-en-2-yl]-1-(benzenesulfonyl)-4,6-dichloroindole-2-carboxylate |
|---|---|
| PubChem CID | 142627137 |
| Molecular Formula | C26H21Cl2N3O5S |
| Molecular Weight | 558.44 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | ethyl 3-[3-(2-aminoanilino)-3-oxoprop-1-en-2-yl]-1-(benzenesulfonyl)-4,6-dichloroindole-2-carboxylate |
| SMILES | C=C(C(=O)Nc1ccccc1N)c1c(C(=O)OCC)n(S(=O)(=O)c2ccccc2)c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C26H21Cl2N3O5S/c1-3-36-26(33)24-22(15(2)25(32)30-20-12-8-7-11-19(20)29)23-18(28)13-16(27)14-21(23)31(24)37(34,35)17-9-5-4-6-10-17/h4-14H,2-3,29H2,1H3,(H,30,32) |
| InChIKey | HIDNWSGZPZGUBI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|