C23H22Cl2N4O4 — CID 142627136
ethyl 3-[3-[2-[carbamoyl(ethyl)amino]anilino]-3-oxoprop-1-en-2-yl]-4,6-dichloro-1H-indole-2-carboxylate (PubChem CID 142627136) has the molecular formula C23H22Cl2N4O4 and a molecular weight of 489.36 g/mol. Its IUPAC name is ethyl 3-[3-[2-[carbamoyl(ethyl)amino]anilino]-3-oxoprop-1-en-2-yl]-4,6-dichloro-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[3-[2-[carbamoyl(ethyl)amino]anilino]-3-oxoprop-1-en-2-yl]-4,6-dichloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 142627136 |
| Molecular Formula | C23H22Cl2N4O4 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | ethyl 3-[3-[2-[carbamoyl(ethyl)amino]anilino]-3-oxoprop-1-en-2-yl]-4,6-dichloro-1H-indole-2-carboxylate |
| SMILES | C=C(C(=O)Nc1ccccc1N(CC)C(N)=O)c1c(C(=O)OCC)[nH]c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C23H22Cl2N4O4/c1-4-29(23(26)32)17-9-7-6-8-15(17)28-21(30)12(3)18-19-14(25)10-13(24)11-16(19)27-20(18)22(31)33-5-2/h6-11,27H,3-5H2,1-2H3,(H2,26,32)(H,28,30) |
| InChIKey | MQNOLENOYXRTCK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|