C20H14Cl3NO4 — CID 22407036
(E)-2-(4-chlorophenyl)-3-(4,6-dichloro-2-ethoxycarbonyl-1H-indol-3-yl)prop-2-enoic acid (PubChem CID 22407036) has the molecular formula C20H14Cl3NO4 and a molecular weight of 438.69 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)-3-(4,6-dichloro-2-ethoxycarbonyl-1H-indol-3-yl)prop-2-enoic acid.
| Compound Name | (E)-2-(4-chlorophenyl)-3-(4,6-dichloro-2-ethoxycarbonyl-1H-indol-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 22407036 |
| Molecular Formula | C20H14Cl3NO4 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | (E)-2-(4-chlorophenyl)-3-(4,6-dichloro-2-ethoxycarbonyl-1H-indol-3-yl)prop-2-enoic acid |
| SMILES | CCOC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1/C=C(/C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14Cl3NO4/c1-2-28-20(27)18-14(17-15(23)7-12(22)8-16(17)24-18)9-13(19(25)26)10-3-5-11(21)6-4-10/h3-9,24H,2H2,1H3,(H,25,26)/b13-9+ |
| InChIKey | VKZVFPNPKAEZOJ-UKTHLTGXSA-N |
| XLogP | 5.93 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|