C16H9Cl2NO5 — CID 72781687
3-[2-carboxy-2-(furan-2-yl)ethenyl]-4,6-dichloro-1H-indole-2-carboxylic acid (PubChem CID 72781687) has the molecular formula C16H9Cl2NO5 and a molecular weight of 366.16 g/mol. Its IUPAC name is 3-[2-carboxy-2-(furan-2-yl)ethenyl]-4,6-dichloro-1H-indole-2-carboxylic acid.
| Compound Name | 3-[2-carboxy-2-(furan-2-yl)ethenyl]-4,6-dichloro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 72781687 |
| Molecular Formula | C16H9Cl2NO5 |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 3-[2-carboxy-2-(furan-2-yl)ethenyl]-4,6-dichloro-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)C(=Cc1c(C(=O)O)[nH]c2cc(Cl)cc(Cl)c12)c1ccco1 |
| InChI | InChI=1S/C16H9Cl2NO5/c17-7-4-10(18)13-9(14(16(22)23)19-11(13)5-7)6-8(15(20)21)12-2-1-3-24-12/h1-6,19H,(H,20,21)(H,22,23) |
| InChIKey | GHAGAHXHDKXFIL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|