C19H14INO4 — CID 67555890
3-[(E)-2-carboxy-2-phenylethenyl]-6-iodo-4-methyl-1H-indole-2-carboxylic acid (PubChem CID 67555890) has the molecular formula C19H14INO4 and a molecular weight of 447.23 g/mol. Its IUPAC name is 3-[(E)-2-carboxy-2-phenylethenyl]-6-iodo-4-methyl-1H-indole-2-carboxylic acid.
| Compound Name | 3-[(E)-2-carboxy-2-phenylethenyl]-6-iodo-4-methyl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 67555890 |
| Molecular Formula | C19H14INO4 |
| Molecular Weight | 447.23 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | 3-[(E)-2-carboxy-2-phenylethenyl]-6-iodo-4-methyl-1H-indole-2-carboxylic acid |
| SMILES | Cc1cc(I)cc2[nH]c(C(=O)O)c(/C=C(/C(=O)O)c3ccccc3)c12 |
| InChI | InChI=1S/C19H14INO4/c1-10-7-12(20)8-15-16(10)14(17(21-15)19(24)25)9-13(18(22)23)11-5-3-2-4-6-11/h2-9,21H,1H3,(H,22,23)(H,24,25)/b13-9+ |
| InChIKey | SJARMQGARBQRFQ-UKTHLTGXSA-N |
| XLogP | 4.40 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.23 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|