C17H9Cl2N3O2 — CID 11739826
4,6-dichloro-3-[(E)-2-cyano-2-pyridin-2-ylethenyl]-1H-indole-2-carboxylic acid (PubChem CID 11739826) has the molecular formula C17H9Cl2N3O2 and a molecular weight of 358.18 g/mol. Its IUPAC name is 4,6-dichloro-3-[(E)-2-cyano-2-pyridin-2-ylethenyl]-1H-indole-2-carboxylic acid.
| Compound Name | 4,6-dichloro-3-[(E)-2-cyano-2-pyridin-2-ylethenyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 11739826 |
| Molecular Formula | C17H9Cl2N3O2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 4,6-dichloro-3-[(E)-2-cyano-2-pyridin-2-ylethenyl]-1H-indole-2-carboxylic acid |
| SMILES | N#C/C(=C/c1c(C(=O)O)[nH]c2cc(Cl)cc(Cl)c12)c1ccccn1 |
| InChI | InChI=1S/C17H9Cl2N3O2/c18-10-6-12(19)15-11(16(17(23)24)22-14(15)7-10)5-9(8-20)13-3-1-2-4-21-13/h1-7,22H,(H,23,24)/b9-5- |
| InChIKey | YFJKZXCMXIMZJL-UITAMQMPSA-N |
| XLogP | 4.63 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|