C19H13Cl2N2O3- — CID 172638011
3-[(E)-3-(benzylamino)-3-oxoprop-1-enyl]-4,6-dichloro-1H-indole-2-carboxylate (PubChem CID 172638011) has the molecular formula C19H13Cl2N2O3- and a molecular weight of 388.23 g/mol. Its IUPAC name is 3-[(E)-3-(benzylamino)-3-oxoprop-1-enyl]-4,6-dichloro-1H-indole-2-carboxylate.
| Compound Name | 3-[(E)-3-(benzylamino)-3-oxoprop-1-enyl]-4,6-dichloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 172638011 |
| Molecular Formula | C19H13Cl2N2O3- |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 3-[(E)-3-(benzylamino)-3-oxoprop-1-enyl]-4,6-dichloro-1H-indole-2-carboxylate |
| SMILES | O=C(/C=C/c1c(C(=O)[O-])[nH]c2cc(Cl)cc(Cl)c12)NCc1ccccc1 |
| InChI | InChI=1S/C19H14Cl2N2O3/c20-12-8-14(21)17-13(18(19(25)26)23-15(17)9-12)6-7-16(24)22-10-11-4-2-1-3-5-11/h1-9,23H,10H2,(H,22,24)(H,25,26)/p-1/b7-6+ |
| InChIKey | UHUGWVWRYRSWAS-VOTSOKGWSA-M |
| XLogP | 3.17 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|