C19H18Cl2N2O2 — CID 10926924
ethyl 3-[(benzylamino)methyl]-4,6-dichloro-1H-indole-2-carboxylate (PubChem CID 10926924) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is ethyl 3-[(benzylamino)methyl]-4,6-dichloro-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[(benzylamino)methyl]-4,6-dichloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 10926924 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | ethyl 3-[(benzylamino)methyl]-4,6-dichloro-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1CNCc1ccccc1 |
| InChI | InChI=1S/C19H18Cl2N2O2/c1-2-25-19(24)18-14(11-22-10-12-6-4-3-5-7-12)17-15(21)8-13(20)9-16(17)23-18/h3-9,22-23H,2,10-11H2,1H3 |
| InChIKey | GVAIIXUWLZCSIK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |