C28H23Cl2N3O5 — CID 54754059
ethyl 4,6-dichloro-3-[[2,4-dioxo-3-(4-phenylmethoxyphenyl)imidazolidin-1-yl]methyl]-1H-indole-2-carboxylate (PubChem CID 54754059) has the molecular formula C28H23Cl2N3O5 and a molecular weight of 552.41 g/mol. Its IUPAC name is ethyl 4,6-dichloro-3-[[2,4-dioxo-3-(4-phenylmethoxyphenyl)imidazolidin-1-yl]methyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 4,6-dichloro-3-[[2,4-dioxo-3-(4-phenylmethoxyphenyl)imidazolidin-1-yl]methyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 54754059 |
| Molecular Formula | C28H23Cl2N3O5 |
| Molecular Weight | 552.41 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | ethyl 4,6-dichloro-3-[[2,4-dioxo-3-(4-phenylmethoxyphenyl)imidazolidin-1-yl]methyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1CN1CC(=O)N(c2ccc(OCc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C28H23Cl2N3O5/c1-2-37-27(35)26-21(25-22(30)12-18(29)13-23(25)31-26)14-32-15-24(34)33(28(32)36)19-8-10-20(11-9-19)38-16-17-6-4-3-5-7-17/h3-13,31H,2,14-16H2,1H3 |
| InChIKey | GBEUDOGWWAAOCL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.41 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|