C23H19Cl2N3O5 — CID 10929042
ethyl 3-[[3-(4-acetylphenyl)-2,4-dioxoimidazolidin-1-yl]methyl]-4,6-dichloro-1H-indole-2-carboxylate (PubChem CID 10929042) has the molecular formula C23H19Cl2N3O5 and a molecular weight of 488.33 g/mol. Its IUPAC name is ethyl 3-[[3-(4-acetylphenyl)-2,4-dioxoimidazolidin-1-yl]methyl]-4,6-dichloro-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[[3-(4-acetylphenyl)-2,4-dioxoimidazolidin-1-yl]methyl]-4,6-dichloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 10929042 |
| Molecular Formula | C23H19Cl2N3O5 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | ethyl 3-[[3-(4-acetylphenyl)-2,4-dioxoimidazolidin-1-yl]methyl]-4,6-dichloro-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1CN1CC(=O)N(c2ccc(C(C)=O)cc2)C1=O |
| InChI | InChI=1S/C23H19Cl2N3O5/c1-3-33-22(31)21-16(20-17(25)8-14(24)9-18(20)26-21)10-27-11-19(30)28(23(27)32)15-6-4-13(5-7-15)12(2)29/h4-9,26H,3,10-11H2,1-2H3 |
| InChIKey | XZKPDNMYZWSBPZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|