About ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate
ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate (PubChem CID 18984729) has the molecular formula C14H14ClNO2
and a molecular weight of 263.72 g/mol. Its IUPAC name is ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate.
Analyze ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate?
The IUPAC name of ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate (CID 18984729) is ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate.
What is the SMILES notation for ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate?
The canonical SMILES for ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate is CCOC(=O)c1[nH]c2cc(Cl)cc3c2c1CCC3.
What is the InChIKey of ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate?
The InChIKey is NKYOGFIBBPDSHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClNO2/c1-2-18-14(17)13-10-5-3-4-8-6-9(15)7-11(16-13)12(8)10/h6-7,16H,2-5H2,1H3.
What are the key properties of ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate?
ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate has a molecular weight of 263.72 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-chloro-1,3,4,5-tetrahydrobenzo[cd]indole-2-carboxylate is sourced from PubChem (CID 18984729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).