C19H14Cl2N2O4 — CID 11732198
4,6-dichloro-3-[(E)-3-(3-(111C)methoxyanilino)-3-oxoprop-1-enyl]-1H-indole-2-carboxylic acid (PubChem CID 11732198) has the molecular formula C19H14Cl2N2O4 and a molecular weight of 404.24 g/mol. Its IUPAC name is 4,6-dichloro-3-[(E)-3-(3-(111C)methoxyanilino)-3-oxoprop-1-enyl]-1H-indole-2-carboxylic acid.
| Compound Name | 4,6-dichloro-3-[(E)-3-(3-(111C)methoxyanilino)-3-oxoprop-1-enyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 11732198 |
| Molecular Formula | C19H14Cl2N2O4 |
| Molecular Weight | 404.24 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 4,6-dichloro-3-[(E)-3-(3-(111C)methoxyanilino)-3-oxoprop-1-enyl]-1H-indole-2-carboxylic acid |
| SMILES | [11CH3]Oc1cccc(NC(=O)/C=C/c2c(C(=O)O)[nH]c3cc(Cl)cc(Cl)c23)c1 |
| InChI | InChI=1S/C19H14Cl2N2O4/c1-27-12-4-2-3-11(9-12)22-16(24)6-5-13-17-14(21)7-10(20)8-15(17)23-18(13)19(25)26/h2-9,23H,1H3,(H,22,24)(H,25,26)/b6-5+/i1-1 |
| InChIKey | HVIZCUHMEYYJNN-NWGPLYLZSA-N |
| XLogP | 4.83 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.24 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|