C21H17Cl2N4NaO4 — CID 23679844
sodium 3-[(E)-3-[4-[(1S)-1-(carbamoylamino)ethyl]anilino]-3-oxoprop-1-enyl]-4,6-dichloro-1H-indole-2-carboxylate (PubChem CID 23679844) has the molecular formula C21H17Cl2N4NaO4 and a molecular weight of 483.29 g/mol. Its IUPAC name is sodium 3-[(E)-3-[4-[(1S)-1-(carbamoylamino)ethyl]anilino]-3-oxoprop-1-enyl]-4,6-dichloro-1H-indole-2-carboxylate.
| Compound Name | sodium 3-[(E)-3-[4-[(1S)-1-(carbamoylamino)ethyl]anilino]-3-oxoprop-1-enyl]-4,6-dichloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 23679844 |
| Molecular Formula | C21H17Cl2N4NaO4 |
| Molecular Weight | 483.29 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | sodium 3-[(E)-3-[4-[(1S)-1-(carbamoylamino)ethyl]anilino]-3-oxoprop-1-enyl]-4,6-dichloro-1H-indole-2-carboxylate |
| SMILES | C[C@H](NC(N)=O)c1ccc(NC(=O)/C=C/c2c(C(=O)[O-])[nH]c3cc(Cl)cc(Cl)c23)cc1.[Na+] |
| InChI | InChI=1S/C21H18Cl2N4O4.Na/c1-10(25-21(24)31)11-2-4-13(5-3-11)26-17(28)7-6-14-18-15(23)8-12(22)9-16(18)27-19(14)20(29)30;/h2-10,27H,1H3,(H,26,28)(H,29,30)(H3,24,25,31);/q;+1/p-1/b7-6+;/t10-;/m0./s1 |
| InChIKey | CRIDIJMSVGEDGV-COAXJOICSA-M |
| XLogP | 0.22 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|