C20H16Cl2N2O4 — CID 173362074
(E)-3-(4,6-dichloro-2-formyl-1H-indol-3-yl)-N-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 173362074) has the molecular formula C20H16Cl2N2O4 and a molecular weight of 419.26 g/mol. Its IUPAC name is (E)-3-(4,6-dichloro-2-formyl-1H-indol-3-yl)-N-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(4,6-dichloro-2-formyl-1H-indol-3-yl)-N-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 173362074 |
| Molecular Formula | C20H16Cl2N2O4 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | (E)-3-(4,6-dichloro-2-formyl-1H-indol-3-yl)-N-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2c(C=O)[nH]c3cc(Cl)cc(Cl)c23)cc1OC |
| InChI | InChI=1S/C20H16Cl2N2O4/c1-27-17-5-3-12(9-18(17)28-2)23-19(26)6-4-13-16(10-25)24-15-8-11(21)7-14(22)20(13)15/h3-10,24H,1-2H3,(H,23,26)/b6-4+ |
| InChIKey | WXDGAENJSZOZTF-GQCTYLIASA-N |
| XLogP | 4.96 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|