C29H18Cl3N3O3 — CID 127043049
4,6-dichloro-3-[(E)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]anilino]-3-oxoprop-1-enyl]-1H-indole-2-carboxylic acid (PubChem CID 127043049) has the molecular formula C29H18Cl3N3O3 and a molecular weight of 562.84 g/mol. Its IUPAC name is 4,6-dichloro-3-[(E)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]anilino]-3-oxoprop-1-enyl]-1H-indole-2-carboxylic acid.
| Compound Name | 4,6-dichloro-3-[(E)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]anilino]-3-oxoprop-1-enyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 127043049 |
| Molecular Formula | C29H18Cl3N3O3 |
| Molecular Weight | 562.84 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | 4,6-dichloro-3-[(E)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]anilino]-3-oxoprop-1-enyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(/C=C/c1c(C(=O)O)[nH]c2cc(Cl)cc(Cl)c12)Nc1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C29H18Cl3N3O3/c30-18-7-5-17-6-9-20(33-24(17)14-18)8-4-16-2-1-3-21(12-16)34-26(36)11-10-22-27-23(32)13-19(31)15-25(27)35-28(22)29(37)38/h1-15,35H,(H,34,36)(H,37,38)/b8-4+,11-10+ |
| InChIKey | JMUFNCJAXSBRSD-IBYINHFXSA-N |
| XLogP | 8.20 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.84 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|