C29H19ClFN3O3 — CID 127043244
3-[(E)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]anilino]-3-oxoprop-1-enyl]-5-fluoro-1H-indole-2-carboxylic acid (PubChem CID 127043244) has the molecular formula C29H19ClFN3O3 and a molecular weight of 511.94 g/mol. Its IUPAC name is 3-[(E)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]anilino]-3-oxoprop-1-enyl]-5-fluoro-1H-indole-2-carboxylic acid.
| Compound Name | 3-[(E)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]anilino]-3-oxoprop-1-enyl]-5-fluoro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 127043244 |
| Molecular Formula | C29H19ClFN3O3 |
| Molecular Weight | 511.94 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 3-[(E)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]anilino]-3-oxoprop-1-enyl]-5-fluoro-1H-indole-2-carboxylic acid |
| SMILES | O=C(/C=C/c1c(C(=O)O)[nH]c2ccc(F)cc12)Nc1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C29H19ClFN3O3/c30-19-7-5-18-6-10-21(32-26(18)15-19)9-4-17-2-1-3-22(14-17)33-27(35)13-11-23-24-16-20(31)8-12-25(24)34-28(23)29(36)37/h1-16,34H,(H,33,35)(H,36,37)/b9-4+,13-11+ |
| InChIKey | SKYIYJVEAPMJBU-VFBBEJETSA-N |
| XLogP | 7.03 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.94 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|