C27H23ClN2O2 — CID 139809581
methyl 2-[3-[[3-[2-(7-chloroquinolin-2-yl)ethenyl]anilino]methyl]phenyl]acetate (PubChem CID 139809581) has the molecular formula C27H23ClN2O2 and a molecular weight of 442.95 g/mol. Its IUPAC name is methyl 2-[3-[[3-[2-(7-chloroquinolin-2-yl)ethenyl]anilino]methyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[[3-[2-(7-chloroquinolin-2-yl)ethenyl]anilino]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 139809581 |
| Molecular Formula | C27H23ClN2O2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | methyl 2-[3-[[3-[2-(7-chloroquinolin-2-yl)ethenyl]anilino]methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(CNc2cccc(C=Cc3ccc4ccc(Cl)cc4n3)c2)c1 |
| InChI | InChI=1S/C27H23ClN2O2/c1-32-27(31)16-20-5-2-6-21(14-20)18-29-25-7-3-4-19(15-25)8-12-24-13-10-22-9-11-23(28)17-26(22)30-24/h2-15,17,29H,16,18H2,1H3 |
| InChIKey | MPBDHLQLWGPQLH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |