C30H21ClN2O4 — CID 127043233
3-[(E)-3-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methoxy]-3-oxoprop-1-enyl]-1H-indole-2-carboxylic acid (PubChem CID 127043233) has the molecular formula C30H21ClN2O4 and a molecular weight of 508.96 g/mol. Its IUPAC name is 3-[(E)-3-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methoxy]-3-oxoprop-1-enyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[(E)-3-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methoxy]-3-oxoprop-1-enyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 127043233 |
| Molecular Formula | C30H21ClN2O4 |
| Molecular Weight | 508.96 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 3-[(E)-3-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methoxy]-3-oxoprop-1-enyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(/C=C/c1c(C(=O)O)[nH]c2ccccc12)OCc1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C30H21ClN2O4/c31-22-11-9-21-10-13-23(32-27(21)17-22)12-8-19-4-3-5-20(16-19)18-37-28(34)15-14-25-24-6-1-2-7-26(24)33-29(25)30(35)36/h1-17,33H,18H2,(H,35,36)/b12-8+,15-14+ |
| InChIKey | NJFATHWGHKUXIF-CCQVQAEASA-N |
| XLogP | 6.99 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.96 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|