C33H28ClN3O2 — CID 45268320
(E)-4-[5-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]but-2-enoic acid (PubChem CID 45268320) has the molecular formula C33H28ClN3O2 and a molecular weight of 534.06 g/mol. Its IUPAC name is (E)-4-[5-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]but-2-enoic acid.
| Compound Name | (E)-4-[5-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 45268320 |
| Molecular Formula | C33H28ClN3O2 |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | (E)-4-[5-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]but-2-enoic acid |
| SMILES | O=C(O)/C=C/CN1CCc2c(c3ccccc3n2Cc2cccc(/C=C/c3ccc4ccc(Cl)cc4n3)c2)C1 |
| InChI | InChI=1S/C33H28ClN3O2/c34-26-13-11-25-12-15-27(35-30(25)20-26)14-10-23-5-3-6-24(19-23)21-37-31-8-2-1-7-28(31)29-22-36(18-16-32(29)37)17-4-9-33(38)39/h1-15,19-20H,16-18,21-22H2,(H,38,39)/b9-4+,14-10+ |
| InChIKey | ZFQPMHOCTSJGGH-VDIYVKJESA-N |
| XLogP | 7.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|