C32H27ClN2O2 — CID 45267392
2-[9-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]acetic acid (PubChem CID 45267392) has the molecular formula C32H27ClN2O2 and a molecular weight of 507.03 g/mol. Its IUPAC name is 2-[9-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]acetic acid.
| Compound Name | 2-[9-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 45267392 |
| Molecular Formula | C32H27ClN2O2 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 2-[9-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCc2c(c3ccccc3n2Cc2cccc(/C=C/c3ccc4ccc(Cl)cc4n3)c2)C1 |
| InChI | InChI=1S/C32H27ClN2O2/c33-25-12-10-24-11-14-26(34-29(24)19-25)13-8-21-4-3-5-23(16-21)20-35-30-7-2-1-6-27(30)28-17-22(18-32(36)37)9-15-31(28)35/h1-8,10-14,16,19,22H,9,15,17-18,20H2,(H,36,37)/b13-8+ |
| InChIKey | NHGLOTPMMQNRGG-MDWZMJQESA-N |
| XLogP | 7.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|