C31H28ClN3O3 — CID 45271619
3-[5-[[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]propanoic acid (PubChem CID 45271619) has the molecular formula C31H28ClN3O3 and a molecular weight of 526.04 g/mol. Its IUPAC name is 3-[5-[[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]propanoic acid.
| Compound Name | 3-[5-[[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 45271619 |
| Molecular Formula | C31H28ClN3O3 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 3-[5-[[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCc2c(c3ccccc3n2Cc2cccc(OCc3ccc4ccc(Cl)cc4n3)c2)C1 |
| InChI | InChI=1S/C31H28ClN3O3/c32-23-10-8-22-9-11-24(33-28(22)17-23)20-38-25-5-3-4-21(16-25)18-35-29-7-2-1-6-26(29)27-19-34(14-12-30(27)35)15-13-31(36)37/h1-11,16-17H,12-15,18-20H2,(H,36,37) |
| InChIKey | UGFDLXGVQIZUGJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|