C38H31ClN2O6 — CID 68690788
1-(3-carboxypropyl)-4-[2-[4-[[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]methoxy]phenyl]ethenyl]indole-3-carboxylic acid (PubChem CID 68690788) has the molecular formula C38H31ClN2O6 and a molecular weight of 647.13 g/mol. Its IUPAC name is 1-(3-carboxypropyl)-4-[2-[4-[[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]methoxy]phenyl]ethenyl]indole-3-carboxylic acid.
| Compound Name | 1-(3-carboxypropyl)-4-[2-[4-[[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]methoxy]phenyl]ethenyl]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 68690788 |
| Molecular Formula | C38H31ClN2O6 |
| Molecular Weight | 647.13 g/mol |
| Exact Mass | 646.19 |
| IUPAC Name | 1-(3-carboxypropyl)-4-[2-[4-[[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]methoxy]phenyl]ethenyl]indole-3-carboxylic acid |
| SMILES | O=C(O)CCCn1cc(C(=O)O)c2c(C=Cc3ccc(OCc4cccc(OCc5ccc6ccc(Cl)cc6n5)c4)cc3)cccc21 |
| InChI | InChI=1S/C38H31ClN2O6/c39-29-15-13-27-14-16-30(40-34(27)21-29)24-47-32-6-1-4-26(20-32)23-46-31-17-10-25(11-18-31)9-12-28-5-2-7-35-37(28)33(38(44)45)22-41(35)19-3-8-36(42)43/h1-2,4-7,9-18,20-22H,3,8,19,23-24H2,(H,42,43)(H,44,45) |
| InChIKey | DCGOGKKUXVJATA-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.13 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|