C10H7Cl2NO3 — CID 142664172
methyl 4,6-dichloro-3-hydroxy-1H-indole-2-carboxylate (PubChem CID 142664172) has the molecular formula C10H7Cl2NO3 and a molecular weight of 260.08 g/mol. Its IUPAC name is methyl 4,6-dichloro-3-hydroxy-1H-indole-2-carboxylate.
| Compound Name | methyl 4,6-dichloro-3-hydroxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 142664172 |
| Molecular Formula | C10H7Cl2NO3 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | methyl 4,6-dichloro-3-hydroxy-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1O |
| InChI | InChI=1S/C10H7Cl2NO3/c1-16-10(15)8-9(14)7-5(12)2-4(11)3-6(7)13-8/h2-3,13-14H,1H3 |
| InChIKey | GZBNOPKVROIHTM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |