C13H8Cl3NO5 — CID 18929910
dimethyl 5,6,7-trichloro-4-oxo-1H-quinoline-2,3-dicarboxylate (PubChem CID 18929910) has the molecular formula C13H8Cl3NO5 and a molecular weight of 364.57 g/mol. Its IUPAC name is dimethyl 5,6,7-trichloro-4-oxo-1H-quinoline-2,3-dicarboxylate.
| Compound Name | dimethyl 5,6,7-trichloro-4-oxo-1H-quinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 18929910 |
| Molecular Formula | C13H8Cl3NO5 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | dimethyl 5,6,7-trichloro-4-oxo-1H-quinoline-2,3-dicarboxylate |
| SMILES | COC(=O)c1[nH]c2cc(Cl)c(Cl)c(Cl)c2c(=O)c1C(=O)OC |
| InChI | InChI=1S/C13H8Cl3NO5/c1-21-12(19)7-10(13(20)22-2)17-5-3-4(14)8(15)9(16)6(5)11(7)18/h3H,1-2H3,(H,17,18) |
| InChIKey | OHCUTQJILGQKIY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|