C14H12FNO5 — CID 134913493
dimethyl 7-fluoro-6-methyl-4-oxo-1H-quinoline-2,3-dicarboxylate (PubChem CID 134913493) has the molecular formula C14H12FNO5 and a molecular weight of 293.25 g/mol. Its IUPAC name is dimethyl 7-fluoro-6-methyl-4-oxo-1H-quinoline-2,3-dicarboxylate.
| Compound Name | dimethyl 7-fluoro-6-methyl-4-oxo-1H-quinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134913493 |
| Molecular Formula | C14H12FNO5 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | dimethyl 7-fluoro-6-methyl-4-oxo-1H-quinoline-2,3-dicarboxylate |
| SMILES | COC(=O)c1[nH]c2cc(F)c(C)cc2c(=O)c1C(=O)OC |
| InChI | InChI=1S/C14H12FNO5/c1-6-4-7-9(5-8(6)15)16-11(14(19)21-3)10(12(7)17)13(18)20-2/h4-5H,1-3H3,(H,16,17) |
| InChIKey | WDAJRLAHSKLVHD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |