C15H16FNO5 — CID 141482034
methyl 6-fluoro-3-(2-hydroxy-3-methoxy-3-oxopropyl)-5-methyl-1H-indole-2-carboxylate (PubChem CID 141482034) has the molecular formula C15H16FNO5 and a molecular weight of 309.29 g/mol. Its IUPAC name is methyl 6-fluoro-3-(2-hydroxy-3-methoxy-3-oxopropyl)-5-methyl-1H-indole-2-carboxylate.
| Compound Name | methyl 6-fluoro-3-(2-hydroxy-3-methoxy-3-oxopropyl)-5-methyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 141482034 |
| Molecular Formula | C15H16FNO5 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl 6-fluoro-3-(2-hydroxy-3-methoxy-3-oxopropyl)-5-methyl-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(F)c(C)cc2c1CC(O)C(=O)OC |
| InChI | InChI=1S/C15H16FNO5/c1-7-4-8-9(5-12(18)14(19)21-2)13(15(20)22-3)17-11(8)6-10(7)16/h4,6,12,17-18H,5H2,1-3H3 |
| InChIKey | VXGWNTUTTUDLJY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|