C17H19F3N2O2 — CID 157122783
3-(5,5-difluoro-4-oxopentyl)-N-ethyl-6-fluoro-5-methyl-1H-indole-2-carboxamide (PubChem CID 157122783) has the molecular formula C17H19F3N2O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is 3-(5,5-difluoro-4-oxopentyl)-N-ethyl-6-fluoro-5-methyl-1H-indole-2-carboxamide.
| Compound Name | 3-(5,5-difluoro-4-oxopentyl)-N-ethyl-6-fluoro-5-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 157122783 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-(5,5-difluoro-4-oxopentyl)-N-ethyl-6-fluoro-5-methyl-1H-indole-2-carboxamide |
| SMILES | CCNC(=O)c1[nH]c2cc(F)c(C)cc2c1CCCC(=O)C(F)F |
| InChI | InChI=1S/C17H19F3N2O2/c1-3-21-17(24)15-10(5-4-6-14(23)16(19)20)11-7-9(2)12(18)8-13(11)22-15/h7-8,16,22H,3-6H2,1-2H3,(H,21,24) |
| InChIKey | AIDZBCMSYPGCNS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|