C29H28ClFN2O4 — CID 58853595
3-[4-[3-[[(5-chloro-3-propyl-1H-indole-2-carbonyl)amino]methyl]-5-fluorophenoxy]-2-methylphenyl]propanoic acid (PubChem CID 58853595) has the molecular formula C29H28ClFN2O4 and a molecular weight of 523.00 g/mol. Its IUPAC name is 3-[4-[3-[[(5-chloro-3-propyl-1H-indole-2-carbonyl)amino]methyl]-5-fluorophenoxy]-2-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[3-[[(5-chloro-3-propyl-1H-indole-2-carbonyl)amino]methyl]-5-fluorophenoxy]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 58853595 |
| Molecular Formula | C29H28ClFN2O4 |
| Molecular Weight | 523.00 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 3-[4-[3-[[(5-chloro-3-propyl-1H-indole-2-carbonyl)amino]methyl]-5-fluorophenoxy]-2-methylphenyl]propanoic acid |
| SMILES | CCCc1c(C(=O)NCc2cc(F)cc(Oc3ccc(CCC(=O)O)c(C)c3)c2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C29H28ClFN2O4/c1-3-4-24-25-14-20(30)7-9-26(25)33-28(24)29(36)32-16-18-12-21(31)15-23(13-18)37-22-8-5-19(17(2)11-22)6-10-27(34)35/h5,7-9,11-15,33H,3-4,6,10,16H2,1-2H3,(H,32,36)(H,34,35) |
| InChIKey | QCXDLTVNJVJRLX-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.00 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|