C30H30ClFN2O4 — CID 58853803
3-[4-[3-[(1S)-1-[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]ethyl]-5-fluorophenoxy]-2-ethylphenyl]propanoic acid (PubChem CID 58853803) has the molecular formula C30H30ClFN2O4 and a molecular weight of 537.03 g/mol. Its IUPAC name is 3-[4-[3-[(1S)-1-[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]ethyl]-5-fluorophenoxy]-2-ethylphenyl]propanoic acid.
| Compound Name | 3-[4-[3-[(1S)-1-[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]ethyl]-5-fluorophenoxy]-2-ethylphenyl]propanoic acid |
|---|---|
| PubChem CID | 58853803 |
| Molecular Formula | C30H30ClFN2O4 |
| Molecular Weight | 537.03 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 3-[4-[3-[(1S)-1-[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]ethyl]-5-fluorophenoxy]-2-ethylphenyl]propanoic acid |
| SMILES | CCc1cc(Oc2cc(F)cc([C@H](C)NC(=O)c3c(C)c4cc(Cl)ccc4n3C)c2)ccc1CCC(=O)O |
| InChI | InChI=1S/C30H30ClFN2O4/c1-5-19-13-24(9-6-20(19)7-11-28(35)36)38-25-14-21(12-23(32)16-25)18(3)33-30(37)29-17(2)26-15-22(31)8-10-27(26)34(29)4/h6,8-10,12-16,18H,5,7,11H2,1-4H3,(H,33,37)(H,35,36)/t18-/m0/s1 |
| InChIKey | OLSUHVQNYCQQTK-SFHVURJKSA-N |
| XLogP | 7.14 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.03 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|