C31H38FNO4S — CID 143058657
3-[4-[3-[1-[[(2Z,5E)-2-[(Z)-but-2-enyl]sulfanyl-3-methylhepta-2,5-dienoyl]amino]ethyl]-5-fluorophenoxy]-2-ethylphenyl]propanoic acid (PubChem CID 143058657) has the molecular formula C31H38FNO4S and a molecular weight of 539.71 g/mol. Its IUPAC name is 3-[4-[3-[1-[[(2Z,5E)-2-[(Z)-but-2-enyl]sulfanyl-3-methylhepta-2,5-dienoyl]amino]ethyl]-5-fluorophenoxy]-2-ethylphenyl]propanoic acid.
| Compound Name | 3-[4-[3-[1-[[(2Z,5E)-2-[(Z)-but-2-enyl]sulfanyl-3-methylhepta-2,5-dienoyl]amino]ethyl]-5-fluorophenoxy]-2-ethylphenyl]propanoic acid |
|---|---|
| PubChem CID | 143058657 |
| Molecular Formula | C31H38FNO4S |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 3-[4-[3-[1-[[(2Z,5E)-2-[(Z)-but-2-enyl]sulfanyl-3-methylhepta-2,5-dienoyl]amino]ethyl]-5-fluorophenoxy]-2-ethylphenyl]propanoic acid |
| SMILES | C/C=C\CS/C(C(=O)NC(C)c1cc(F)cc(Oc2ccc(CCC(=O)O)c(CC)c2)c1)=C(/C)C/C=C/C |
| InChI | InChI=1S/C31H38FNO4S/c1-6-9-11-21(4)30(38-16-10-7-2)31(36)33-22(5)25-17-26(32)20-28(19-25)37-27-14-12-24(13-15-29(34)35)23(8-3)18-27/h6-7,9-10,12,14,17-20,22H,8,11,13,15-16H2,1-5H3,(H,33,36)(H,34,35)/b9-6+,10-7-,30-21- |
| InChIKey | VBKPHMWLXOXTSC-BDHILCSQSA-N |
| XLogP | 7.92 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|