C31H34ClFN2O4 — CID 143058664
3-[4-[3-[1-[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]ethyl]-5-fluorophenoxy]-2-methylphenyl]propanoic acid;ethane (PubChem CID 143058664) has the molecular formula C31H34ClFN2O4 and a molecular weight of 553.07 g/mol. Its IUPAC name is 3-[4-[3-[1-[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]ethyl]-5-fluorophenoxy]-2-methylphenyl]propanoic acid;ethane.
| Compound Name | 3-[4-[3-[1-[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]ethyl]-5-fluorophenoxy]-2-methylphenyl]propanoic acid;ethane |
|---|---|
| PubChem CID | 143058664 |
| Molecular Formula | C31H34ClFN2O4 |
| Molecular Weight | 553.07 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 3-[4-[3-[1-[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]ethyl]-5-fluorophenoxy]-2-methylphenyl]propanoic acid;ethane |
| SMILES | CC.Cc1cc(Oc2cc(F)cc(C(C)NC(=O)c3c(C)c4cc(Cl)ccc4n3C)c2)ccc1CCC(=O)O |
| InChI | InChI=1S/C29H28ClFN2O4.C2H6/c1-16-11-23(8-5-19(16)6-10-27(34)35)37-24-13-20(12-22(31)15-24)18(3)32-29(36)28-17(2)25-14-21(30)7-9-26(25)33(28)4;1-2/h5,7-9,11-15,18H,6,10H2,1-4H3,(H,32,36)(H,34,35);1-2H3 |
| InChIKey | IZQHMOOBLIONAH-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.07 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|