C30H31ClN2O4 — CID 69115921
3-[4-[3-[1-[(5-chloro-3-propyl-1H-indole-2-carbonyl)amino]ethyl]phenoxy]-2-methylphenyl]propanoic acid (PubChem CID 69115921) has the molecular formula C30H31ClN2O4 and a molecular weight of 519.04 g/mol. Its IUPAC name is 3-[4-[3-[1-[(5-chloro-3-propyl-1H-indole-2-carbonyl)amino]ethyl]phenoxy]-2-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[3-[1-[(5-chloro-3-propyl-1H-indole-2-carbonyl)amino]ethyl]phenoxy]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 69115921 |
| Molecular Formula | C30H31ClN2O4 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 3-[4-[3-[1-[(5-chloro-3-propyl-1H-indole-2-carbonyl)amino]ethyl]phenoxy]-2-methylphenyl]propanoic acid |
| SMILES | CCCc1c(C(=O)NC(C)c2cccc(Oc3ccc(CCC(=O)O)c(C)c3)c2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C30H31ClN2O4/c1-4-6-25-26-17-22(31)11-13-27(26)33-29(25)30(36)32-19(3)21-7-5-8-23(16-21)37-24-12-9-20(18(2)15-24)10-14-28(34)35/h5,7-9,11-13,15-17,19,33H,4,6,10,14H2,1-3H3,(H,32,36)(H,34,35) |
| InChIKey | YYLNXEJIIZZLKV-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|