C29H29ClN2O5 — CID 58853688
2-[4-[3-[[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]methyl]phenoxy]-2-methylphenoxy]-2-methylpropanoic acid (PubChem CID 58853688) has the molecular formula C29H29ClN2O5 and a molecular weight of 521.01 g/mol. Its IUPAC name is 2-[4-[3-[[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]methyl]phenoxy]-2-methylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[3-[[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]methyl]phenoxy]-2-methylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 58853688 |
| Molecular Formula | C29H29ClN2O5 |
| Molecular Weight | 521.01 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 2-[4-[3-[[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]methyl]phenoxy]-2-methylphenoxy]-2-methylpropanoic acid |
| SMILES | Cc1cc(Oc2cccc(CNC(=O)c3c(C)c4cc(Cl)ccc4n3C)c2)ccc1OC(C)(C)C(=O)O |
| InChI | InChI=1S/C29H29ClN2O5/c1-17-13-22(10-12-25(17)37-29(3,4)28(34)35)36-21-8-6-7-19(14-21)16-31-27(33)26-18(2)23-15-20(30)9-11-24(23)32(26)5/h6-15H,16H2,1-5H3,(H,31,33)(H,34,35) |
| InChIKey | VJFXESPLQJVHLC-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.01 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|