C32H38F2N2O4 — CID 143058694
3-[2-ethyl-4-[3-fluoro-5-[1-[[(2Z,5E)-6-fluoro-3-methyl-4-methylidene-2-[methyl(prop-2-enyl)amino]hepta-2,5-dienoyl]amino]ethyl]phenoxy]phenyl]propanoic acid (PubChem CID 143058694) has the molecular formula C32H38F2N2O4 and a molecular weight of 552.66 g/mol. Its IUPAC name is 3-[2-ethyl-4-[3-fluoro-5-[1-[[(2Z,5E)-6-fluoro-3-methyl-4-methylidene-2-[methyl(prop-2-enyl)amino]hepta-2,5-dienoyl]amino]ethyl]phenoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-ethyl-4-[3-fluoro-5-[1-[[(2Z,5E)-6-fluoro-3-methyl-4-methylidene-2-[methyl(prop-2-enyl)amino]hepta-2,5-dienoyl]amino]ethyl]phenoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143058694 |
| Molecular Formula | C32H38F2N2O4 |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 3-[2-ethyl-4-[3-fluoro-5-[1-[[(2Z,5E)-6-fluoro-3-methyl-4-methylidene-2-[methyl(prop-2-enyl)amino]hepta-2,5-dienoyl]amino]ethyl]phenoxy]phenyl]propanoic acid |
| SMILES | C=CCN(C)/C(C(=O)NC(C)c1cc(F)cc(Oc2ccc(CCC(=O)O)c(CC)c2)c1)=C(/C)C(=C)/C=C(\C)F |
| InChI | InChI=1S/C32H38F2N2O4/c1-8-14-36(7)31(22(5)20(3)15-21(4)33)32(39)35-23(6)26-16-27(34)19-29(18-26)40-28-12-10-25(11-13-30(37)38)24(9-2)17-28/h8,10,12,15-19,23H,1,3,9,11,13-14H2,2,4-7H3,(H,35,39)(H,37,38)/b21-15+,31-22- |
| InChIKey | ADJYLDQDURJIGZ-MHMSRHEJSA-N |
| XLogP | 7.20 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|