C23H17Cl3FN3O2 — CID 89041799
N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-5-chloro-3-methyl-1H-indole-2-carboxamide (PubChem CID 89041799) has the molecular formula C23H17Cl3FN3O2 and a molecular weight of 492.77 g/mol. Its IUPAC name is N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-5-chloro-3-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-5-chloro-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 89041799 |
| Molecular Formula | C23H17Cl3FN3O2 |
| Molecular Weight | 492.77 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-5-chloro-3-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccc(Cl)c(Oc3cc(N)cc(Cl)c3)c2F)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H17Cl3FN3O2/c1-11-17-8-13(24)3-5-19(17)30-21(11)23(31)29-10-12-2-4-18(26)22(20(12)27)32-16-7-14(25)6-15(28)9-16/h2-9,30H,10,28H2,1H3,(H,29,31) |
| InChIKey | MKRYILVWIHXXAW-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.77 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|