C25H22Cl2FN5O3 — CID 89218490
N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-5-(3-aminopropanoylamino)-1H-indole-2-carboxamide (PubChem CID 89218490) has the molecular formula C25H22Cl2FN5O3 and a molecular weight of 530.39 g/mol. Its IUPAC name is N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-5-(3-aminopropanoylamino)-1H-indole-2-carboxamide.
| Compound Name | N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-5-(3-aminopropanoylamino)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 89218490 |
| Molecular Formula | C25H22Cl2FN5O3 |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-5-(3-aminopropanoylamino)-1H-indole-2-carboxamide |
| SMILES | NCCC(=O)Nc1ccc2[nH]c(C(=O)NCc3ccc(Cl)c(Oc4cc(N)cc(Cl)c4)c3F)cc2c1 |
| InChI | InChI=1S/C25H22Cl2FN5O3/c26-15-9-16(30)11-18(10-15)36-24-19(27)3-1-13(23(24)28)12-31-25(35)21-8-14-7-17(2-4-20(14)33-21)32-22(34)5-6-29/h1-4,7-11,33H,5-6,12,29-30H2,(H,31,35)(H,32,34) |
| InChIKey | NNSZFMCEOQYSJW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 135.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|