C17H13Cl2FN4O2S — CID 89218499
N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-4-methylthiadiazole-5-carboxamide (PubChem CID 89218499) has the molecular formula C17H13Cl2FN4O2S and a molecular weight of 427.29 g/mol. Its IUPAC name is N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 89218499 |
| Molecular Formula | C17H13Cl2FN4O2S |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NCc1ccc(Cl)c(Oc2cc(N)cc(Cl)c2)c1F |
| InChI | InChI=1S/C17H13Cl2FN4O2S/c1-8-16(27-24-23-8)17(25)22-7-9-2-3-13(19)15(14(9)20)26-12-5-10(18)4-11(21)6-12/h2-6H,7,21H2,1H3,(H,22,25) |
| InChIKey | DPPXSEZUJZQORM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|