C19H17Cl2FN4O2 — CID 89218459
N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-N-ethyl-1H-imidazole-5-carboxamide (PubChem CID 89218459) has the molecular formula C19H17Cl2FN4O2 and a molecular weight of 423.28 g/mol. Its IUPAC name is N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-N-ethyl-1H-imidazole-5-carboxamide.
| Compound Name | N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-N-ethyl-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 89218459 |
| Molecular Formula | C19H17Cl2FN4O2 |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-[[3-(3-amino-5-chlorophenoxy)-4-chloro-2-fluorophenyl]methyl]-N-ethyl-1H-imidazole-5-carboxamide |
| SMILES | CCN(Cc1ccc(Cl)c(Oc2cc(N)cc(Cl)c2)c1F)C(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C19H17Cl2FN4O2/c1-2-26(19(27)16-8-24-10-25-16)9-11-3-4-15(21)18(17(11)22)28-14-6-12(20)5-13(23)7-14/h3-8,10H,2,9,23H2,1H3,(H,24,25) |
| InChIKey | PHRDFWLPYNWSTM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|