C25H30ClN3O2 — CID 118727855
5-chloro-3-ethyl-N-[2-[4-(hexanoylamino)phenyl]ethyl]-1H-indole-2-carboxamide (PubChem CID 118727855) has the molecular formula C25H30ClN3O2 and a molecular weight of 439.99 g/mol. Its IUPAC name is 5-chloro-3-ethyl-N-[2-[4-(hexanoylamino)phenyl]ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-ethyl-N-[2-[4-(hexanoylamino)phenyl]ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 118727855 |
| Molecular Formula | C25H30ClN3O2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 5-chloro-3-ethyl-N-[2-[4-(hexanoylamino)phenyl]ethyl]-1H-indole-2-carboxamide |
| SMILES | CCCCCC(=O)Nc1ccc(CCNC(=O)c2[nH]c3ccc(Cl)cc3c2CC)cc1 |
| InChI | InChI=1S/C25H30ClN3O2/c1-3-5-6-7-23(30)28-19-11-8-17(9-12-19)14-15-27-25(31)24-20(4-2)21-16-18(26)10-13-22(21)29-24/h8-13,16,29H,3-7,14-15H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | RCNJZTHWNBKXOO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|