C26H33ClN4O — CID 169175710
5-chloro-3-[[ethyl(methyl)amino]methyl]-N-[2-(4-piperidin-1-ylphenyl)ethyl]-1H-indole-2-carboxamide (PubChem CID 169175710) has the molecular formula C26H33ClN4O and a molecular weight of 453.03 g/mol. Its IUPAC name is 5-chloro-3-[[ethyl(methyl)amino]methyl]-N-[2-(4-piperidin-1-ylphenyl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[[ethyl(methyl)amino]methyl]-N-[2-(4-piperidin-1-ylphenyl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 169175710 |
| Molecular Formula | C26H33ClN4O |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 5-chloro-3-[[ethyl(methyl)amino]methyl]-N-[2-(4-piperidin-1-ylphenyl)ethyl]-1H-indole-2-carboxamide |
| SMILES | CCN(C)Cc1c(C(=O)NCCc2ccc(N3CCCCC3)cc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C26H33ClN4O/c1-3-30(2)18-23-22-17-20(27)9-12-24(22)29-25(23)26(32)28-14-13-19-7-10-21(11-8-19)31-15-5-4-6-16-31/h7-12,17,29H,3-6,13-16,18H2,1-2H3,(H,28,32) |
| InChIKey | GPGMZDYBWQWBJN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|