C19H19ClN2O2 — CID 118728584
5-chloro-3-ethyl-N-[2-(3-hydroxyphenyl)ethyl]-1H-indole-2-carboxamide (PubChem CID 118728584) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 5-chloro-3-ethyl-N-[2-(3-hydroxyphenyl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-ethyl-N-[2-(3-hydroxyphenyl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 118728584 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 5-chloro-3-ethyl-N-[2-(3-hydroxyphenyl)ethyl]-1H-indole-2-carboxamide |
| SMILES | CCc1c(C(=O)NCCc2cccc(O)c2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H19ClN2O2/c1-2-15-16-11-13(20)6-7-17(16)22-18(15)19(24)21-9-8-12-4-3-5-14(23)10-12/h3-7,10-11,22-23H,2,8-9H2,1H3,(H,21,24) |
| InChIKey | UFLLNLMDBQIUTH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|