C19H17Cl3N2O — CID 118728586
5-chloro-N-[2-(3,4-dichlorophenyl)ethyl]-3-ethyl-1H-indole-2-carboxamide (PubChem CID 118728586) has the molecular formula C19H17Cl3N2O and a molecular weight of 395.72 g/mol. Its IUPAC name is 5-chloro-N-[2-(3,4-dichlorophenyl)ethyl]-3-ethyl-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(3,4-dichlorophenyl)ethyl]-3-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 118728586 |
| Molecular Formula | C19H17Cl3N2O |
| Molecular Weight | 395.72 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 5-chloro-N-[2-(3,4-dichlorophenyl)ethyl]-3-ethyl-1H-indole-2-carboxamide |
| SMILES | CCc1c(C(=O)NCCc2ccc(Cl)c(Cl)c2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H17Cl3N2O/c1-2-13-14-10-12(20)4-6-17(14)24-18(13)19(25)23-8-7-11-3-5-15(21)16(22)9-11/h3-6,9-10,24H,2,7-8H2,1H3,(H,23,25) |
| InChIKey | FCVSHSNEIJRSAD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|