C18H20ClN5O — CID 72842739
N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-2-(ethylamino)pyrimidine-5-carboxamide (PubChem CID 72842739) has the molecular formula C18H20ClN5O and a molecular weight of 357.85 g/mol. Its IUPAC name is N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-2-(ethylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-2-(ethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72842739 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-2-(ethylamino)pyrimidine-5-carboxamide |
| SMILES | CCNc1ncc(C(=O)NCCc2c(C)[nH]c3ccc(Cl)cc23)cn1 |
| InChI | InChI=1S/C18H20ClN5O/c1-3-20-18-22-9-12(10-23-18)17(25)21-7-6-14-11(2)24-16-5-4-13(19)8-15(14)16/h4-5,8-10,24H,3,6-7H2,1-2H3,(H,21,25)(H,20,22,23) |
| InChIKey | UXRVTLQAASRUDC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|