C31H23Cl2NO6S — CID 11330941
(E)-3-[4,6-dichloro-2-ethoxycarbonyl-1-(4-methylphenyl)sulfonylindol-3-yl]-2-naphthalen-1-ylprop-2-enoic acid (PubChem CID 11330941) has the molecular formula C31H23Cl2NO6S and a molecular weight of 608.50 g/mol. Its IUPAC name is (E)-3-[4,6-dichloro-2-ethoxycarbonyl-1-(4-methylphenyl)sulfonylindol-3-yl]-2-naphthalen-1-ylprop-2-enoic acid.
| Compound Name | (E)-3-[4,6-dichloro-2-ethoxycarbonyl-1-(4-methylphenyl)sulfonylindol-3-yl]-2-naphthalen-1-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 11330941 |
| Molecular Formula | C31H23Cl2NO6S |
| Molecular Weight | 608.50 g/mol |
| Exact Mass | 607.06 |
| IUPAC Name | (E)-3-[4,6-dichloro-2-ethoxycarbonyl-1-(4-methylphenyl)sulfonylindol-3-yl]-2-naphthalen-1-ylprop-2-enoic acid |
| SMILES | CCOC(=O)c1c(/C=C(/C(=O)O)c2cccc3ccccc23)c2c(Cl)cc(Cl)cc2n1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H23Cl2NO6S/c1-3-40-31(37)29-25(17-24(30(35)36)23-10-6-8-19-7-4-5-9-22(19)23)28-26(33)15-20(32)16-27(28)34(29)41(38,39)21-13-11-18(2)12-14-21/h4-17H,3H2,1-2H3,(H,35,36)/b24-17+ |
| InChIKey | APVCBWPGBNWMSQ-JJIBRWJFSA-N |
| XLogP | 7.45 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.50 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|